About 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde
3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde (PubChem CID 174387145) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
| PubChem CID | 174387145 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
| SMILES | C=C1CC(C)(C)C(N(C)C)=CC1C=O |
| InChI | InChI=1S/C12H19NO/c1-9-7-12(2,3)11(13(4)5)6-10(9)8-14/h6,8,10H,1,7H2,2-5H3 |
| InChIKey | SKJBPQGTFHWPRU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
The IUPAC name of 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde (CID 174387145) is 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde.
What is the SMILES notation for 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
The canonical SMILES for 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde is C=C1CC(C)(C)C(N(C)C)=CC1C=O.
What is the InChIKey of 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
The InChIKey is SKJBPQGTFHWPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-9-7-12(2,3)11(13(4)5)6-10(9)8-14/h6,8,10H,1,7H2,2-5H3.
What are the key properties of 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde?
3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde has a molecular weight of 193.29 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde is sourced from PubChem (CID 174387145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).