C12H19NO — CID 18320432
2-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one (PubChem CID 18320432) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one.
| Compound Name | 2-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
|---|---|
| PubChem CID | 18320432 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-(ethylaminomethyl)-4,4-dimethyl-6-methylidenecyclohex-2-en-1-one |
| SMILES | C=C1CC(C)(C)C=C(CNCC)C1=O |
| InChI | InChI=1S/C12H19NO/c1-5-13-8-10-7-12(3,4)6-9(2)11(10)14/h7,13H,2,5-6,8H2,1,3-4H3 |
| InChIKey | WHFXQIKQRPIGCW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|