C7H9N — CID 91962457
3,3-dimethylcyclobutene-1-carbonitrile (PubChem CID 91962457) has the molecular formula C7H9N and a molecular weight of 107.16 g/mol. Its IUPAC name is 3,3-dimethylcyclobutene-1-carbonitrile.
| Compound Name | 3,3-dimethylcyclobutene-1-carbonitrile |
|---|---|
| PubChem CID | 91962457 |
| Molecular Formula | C7H9N |
| Molecular Weight | 107.16 g/mol |
| Exact Mass | 107.07 |
| IUPAC Name | 3,3-dimethylcyclobutene-1-carbonitrile |
| SMILES | CC1(C)C=C(C#N)C1 |
| InChI | InChI=1S/C7H9N/c1-7(2)3-6(4-7)5-8/h3H,4H2,1-2H3 |
| InChIKey | DSOKOJMIZYQKRY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |