C22H24N2O5S — CID 174389226
methyl 2-[[amino-(2-benzoyl-5-methylphenyl)methyl]-prop-2-enylsulfonylamino]prop-2-enoate (PubChem CID 174389226) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 2-[[amino-(2-benzoyl-5-methylphenyl)methyl]-prop-2-enylsulfonylamino]prop-2-enoate.
| Compound Name | methyl 2-[[amino-(2-benzoyl-5-methylphenyl)methyl]-prop-2-enylsulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 174389226 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl 2-[[amino-(2-benzoyl-5-methylphenyl)methyl]-prop-2-enylsulfonylamino]prop-2-enoate |
| SMILES | C=CCS(=O)(=O)N(C(=C)C(=O)OC)C(N)c1cc(C)ccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-5-13-30(27,28)24(16(3)22(26)29-4)21(23)19-14-15(2)11-12-18(19)20(25)17-9-7-6-8-10-17/h5-12,14,21H,1,3,13,23H2,2,4H3 |
| InChIKey | HFSIGBAXNJPIFZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|