C26H26N2O6S — CID 18612720
methyl 2-[(2-benzamido-5-methylphenyl)methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate (PubChem CID 18612720) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is methyl 2-[(2-benzamido-5-methylphenyl)methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate.
| Compound Name | methyl 2-[(2-benzamido-5-methylphenyl)methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 18612720 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | methyl 2-[(2-benzamido-5-methylphenyl)methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate |
| SMILES | C=C(C(=O)OC)N(Cc1cc(C)ccc1NC(=O)c1ccccc1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H26N2O6S/c1-18-10-15-24(27-25(29)20-8-6-5-7-9-20)21(16-18)17-28(19(2)26(30)34-4)35(31,32)23-13-11-22(33-3)12-14-23/h5-16H,2,17H2,1,3-4H3,(H,27,29) |
| InChIKey | MRJRBNJAWRAIAJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|