C23H27N3O7S — CID 56997557
methyl 2-[(4-methoxyphenyl)sulfonyl-[[2-(morpholine-4-carbonylamino)phenyl]methyl]amino]prop-2-enoate (PubChem CID 56997557) has the molecular formula C23H27N3O7S and a molecular weight of 489.55 g/mol. Its IUPAC name is methyl 2-[(4-methoxyphenyl)sulfonyl-[[2-(morpholine-4-carbonylamino)phenyl]methyl]amino]prop-2-enoate.
| Compound Name | methyl 2-[(4-methoxyphenyl)sulfonyl-[[2-(morpholine-4-carbonylamino)phenyl]methyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 56997557 |
| Molecular Formula | C23H27N3O7S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl 2-[(4-methoxyphenyl)sulfonyl-[[2-(morpholine-4-carbonylamino)phenyl]methyl]amino]prop-2-enoate |
| SMILES | C=C(C(=O)OC)N(Cc1ccccc1NC(=O)N1CCOCC1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27N3O7S/c1-17(22(27)32-3)26(34(29,30)20-10-8-19(31-2)9-11-20)16-18-6-4-5-7-21(18)24-23(28)25-12-14-33-15-13-25/h4-11H,1,12-16H2,2-3H3,(H,24,28) |
| InChIKey | HNGZPCUCZVDHTG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|