C12H17N3O5S — CID 78994050
N-(2-methoxy-5-sulfamoylphenyl)morpholine-4-carboxamide (PubChem CID 78994050) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(2-methoxy-5-sulfamoylphenyl)morpholine-4-carboxamide.
| Compound Name | N-(2-methoxy-5-sulfamoylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 78994050 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(2-methoxy-5-sulfamoylphenyl)morpholine-4-carboxamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H17N3O5S/c1-19-11-3-2-9(21(13,17)18)8-10(11)14-12(16)15-4-6-20-7-5-15/h2-3,8H,4-7H2,1H3,(H,14,16)(H2,13,17,18) |
| InChIKey | WXNBVUYVULOXDJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |