C12H17N3O5S — CID 64892328
3-amino-N-(2-methoxy-5-sulfamoylphenyl)oxolane-3-carboxamide (PubChem CID 64892328) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-amino-N-(2-methoxy-5-sulfamoylphenyl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(2-methoxy-5-sulfamoylphenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 64892328 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-amino-N-(2-methoxy-5-sulfamoylphenyl)oxolane-3-carboxamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1NC(=O)C1(N)CCOC1 |
| InChI | InChI=1S/C12H17N3O5S/c1-19-10-3-2-8(21(14,17)18)6-9(10)15-11(16)12(13)4-5-20-7-12/h2-3,6H,4-5,7,13H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | CNEKUGMBVBKRHT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |