C22H25N3O7S — CID 18612963
methyl 2-[[2-[(2-acetamidoacetyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate (PubChem CID 18612963) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is methyl 2-[[2-[(2-acetamidoacetyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate.
| Compound Name | methyl 2-[[2-[(2-acetamidoacetyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate |
|---|---|
| PubChem CID | 18612963 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | methyl 2-[[2-[(2-acetamidoacetyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoate |
| SMILES | C=C(C(=O)OC)N(Cc1ccccc1NC(=O)CNC(C)=O)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25N3O7S/c1-15(22(28)32-4)25(33(29,30)19-11-9-18(31-3)10-12-19)14-17-7-5-6-8-20(17)24-21(27)13-23-16(2)26/h5-12H,1,13-14H2,2-4H3,(H,23,26)(H,24,27) |
| InChIKey | VTYZUYKYWNASNB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|