C24H20ClFN2O6S — CID 141013012
2-[[2-[(2-chloro-4-fluorobenzoyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoic acid (PubChem CID 141013012) has the molecular formula C24H20ClFN2O6S and a molecular weight of 518.95 g/mol. Its IUPAC name is 2-[[2-[(2-chloro-4-fluorobenzoyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoic acid.
| Compound Name | 2-[[2-[(2-chloro-4-fluorobenzoyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 141013012 |
| Molecular Formula | C24H20ClFN2O6S |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | 2-[[2-[(2-chloro-4-fluorobenzoyl)amino]phenyl]methyl-(4-methoxyphenyl)sulfonylamino]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)N(Cc1ccccc1NC(=O)c1ccc(F)cc1Cl)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H20ClFN2O6S/c1-15(24(30)31)28(35(32,33)19-10-8-18(34-2)9-11-19)14-16-5-3-4-6-22(16)27-23(29)20-12-7-17(26)13-21(20)25/h3-13H,1,14H2,2H3,(H,27,29)(H,30,31) |
| InChIKey | AEHQKYXZNMXGNV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|