C21H27NO2 — CID 174391499
N-(6-benzylidene-1,4,7,7-tetramethyl-5-oxo-2-bicyclo[2.2.1]heptanyl)propanamide (PubChem CID 174391499) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is N-(6-benzylidene-1,4,7,7-tetramethyl-5-oxo-2-bicyclo[2.2.1]heptanyl)propanamide.
| Compound Name | N-(6-benzylidene-1,4,7,7-tetramethyl-5-oxo-2-bicyclo[2.2.1]heptanyl)propanamide |
|---|---|
| PubChem CID | 174391499 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N-(6-benzylidene-1,4,7,7-tetramethyl-5-oxo-2-bicyclo[2.2.1]heptanyl)propanamide |
| SMILES | CCC(=O)NC1CC2(C)C(=O)C(=Cc3ccccc3)C1(C)C2(C)C |
| InChI | InChI=1S/C21H27NO2/c1-6-17(23)22-16-13-20(4)18(24)15(21(16,5)19(20,2)3)12-14-10-8-7-9-11-14/h7-12,16H,6,13H2,1-5H3,(H,22,23) |
| InChIKey | QZOABAQXKUADIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|