C18H23N3O — CID 174391824
N-[3-imino-5-(3-methoxyphenyl)hexyl]pyridin-2-amine (PubChem CID 174391824) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[3-imino-5-(3-methoxyphenyl)hexyl]pyridin-2-amine.
| Compound Name | N-[3-imino-5-(3-methoxyphenyl)hexyl]pyridin-2-amine |
|---|---|
| PubChem CID | 174391824 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[3-imino-5-(3-methoxyphenyl)hexyl]pyridin-2-amine |
| SMILES | [H]/N=C(\CCNc1ccccn1)CC(C)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H23N3O/c1-14(15-6-5-7-17(13-15)22-2)12-16(19)9-11-21-18-8-3-4-10-20-18/h3-8,10,13-14,19H,9,11-12H2,1-2H3,(H,20,21)/b19-16+ |
| InChIKey | FKCMYUQFMQRXON-KNTRCKAVSA-N |
| XLogP | 4.11 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|