C15H17N3O4 — CID 174393547
ethyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate (PubChem CID 174393547) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate.
| Compound Name | ethyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 174393547 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | ethyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate |
| SMILES | CCOC(=O)CC(C)Oc1ccc(-c2ncncn2)c(O)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-3-21-14(20)6-10(2)22-11-4-5-12(13(19)7-11)15-17-8-16-9-18-15/h4-5,7-10,19H,3,6H2,1-2H3 |
| InChIKey | RMOUCBPFTNAJHU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |