C14H15N3O4 — CID 175234484
methyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate (PubChem CID 175234484) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is methyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate.
| Compound Name | methyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 175234484 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | methyl 3-[3-hydroxy-4-(1,3,5-triazin-2-yl)phenoxy]butanoate |
| SMILES | COC(=O)CC(C)Oc1ccc(-c2ncncn2)c(O)c1 |
| InChI | InChI=1S/C14H15N3O4/c1-9(5-13(19)20-2)21-10-3-4-11(12(18)6-10)14-16-7-15-8-17-14/h3-4,6-9,18H,5H2,1-2H3 |
| InChIKey | LWSNHSCLGAIGJC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |