C12H13NO4 — CID 174394787
2-(2-nitropent-1-enyl)-1,3-benzodioxole (PubChem CID 174394787) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(2-nitropent-1-enyl)-1,3-benzodioxole.
| Compound Name | 2-(2-nitropent-1-enyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 174394787 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(2-nitropent-1-enyl)-1,3-benzodioxole |
| SMILES | CCCC(=CC1Oc2ccccc2O1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H13NO4/c1-2-5-9(13(14)15)8-12-16-10-6-3-4-7-11(10)17-12/h3-4,6-8,12H,2,5H2,1H3 |
| InChIKey | PPCMWURLGXYSCQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|