C23H26O4S — CID 174395522
prop-2-enylsulfonyl 2-methyl-5-phenyl-2-(2-phenylethenyl)pentanoate (PubChem CID 174395522) has the molecular formula C23H26O4S and a molecular weight of 398.52 g/mol. Its IUPAC name is prop-2-enylsulfonyl 2-methyl-5-phenyl-2-(2-phenylethenyl)pentanoate.
| Compound Name | prop-2-enylsulfonyl 2-methyl-5-phenyl-2-(2-phenylethenyl)pentanoate |
|---|---|
| PubChem CID | 174395522 |
| Molecular Formula | C23H26O4S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | prop-2-enylsulfonyl 2-methyl-5-phenyl-2-(2-phenylethenyl)pentanoate |
| SMILES | C=CCS(=O)(=O)OC(=O)C(C)(C=Cc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C23H26O4S/c1-3-19-28(25,26)27-22(24)23(2,18-16-21-13-8-5-9-14-21)17-10-15-20-11-6-4-7-12-20/h3-9,11-14,16,18H,1,10,15,17,19H2,2H3 |
| InChIKey | SEXMSDSCQFTICR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|