C11H19NO4 — CID 174397998
2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid (PubChem CID 174397998) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid.
| Compound Name | 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 174397998 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid |
| SMILES | CCC(C)=C(C)C(=O)ONC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-6-7(2)8(3)9(13)16-12-11(4,5)10(14)15/h12H,6H2,1-5H3,(H,14,15) |
| InChIKey | PJILARGUCVRPBX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|