2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid

C11H19NO4 — CID 174397998

IUPAC2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid
SMILESCCC(C)=C(C)C(=O)ONC(C)(C)C(=O)O
InChIInChI=1S/C11H19NO4/c1-6-7(2)8(3)9(13)16-12-11(4,5)10(14)15/h12H,6H2,1-5H3,(H,14,15)
InChIKeyPJILARGUCVRPBX-UHFFFAOYSA-N
MW229.28 g/mol
LogP1.64
Rot. Bonds5

About 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid

2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid (PubChem CID 174397998) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid.

Molecular Properties

Compound Name2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid
PubChem CID174397998
Molecular FormulaC11H19NO4
Molecular Weight229.28 g/mol
Exact Mass229.13
IUPAC Name2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid
SMILESCCC(C)=C(C)C(=O)ONC(C)(C)C(=O)O
InChIInChI=1S/C11H19NO4/c1-6-7(2)8(3)9(13)16-12-11(4,5)10(14)15/h12H,6H2,1-5H3,(H,14,15)
InChIKeyPJILARGUCVRPBX-UHFFFAOYSA-N
XLogP1.64
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.28
LogP ≤ 51.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid?
The IUPAC name of 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid (CID 174397998) is 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid.
What is the SMILES notation for 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid?
The canonical SMILES for 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid is CCC(C)=C(C)C(=O)ONC(C)(C)C(=O)O.
What is the InChIKey of 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid?
The InChIKey is PJILARGUCVRPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4/c1-6-7(2)8(3)9(13)16-12-11(4,5)10(14)15/h12H,6H2,1-5H3,(H,14,15).
What are the key properties of 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid?
2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid has a molecular weight of 229.28 g/mol, XLogP of 1.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylpent-2-enoyloxyamino)-2-methylpropanoic acid is sourced from PubChem (CID 174397998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).