C13H18BrClLiO3P — CID 174399366
lithium;(3-bromo-5-chloro-2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride (PubChem CID 174399366) has the molecular formula C13H18BrClLiO3P and a molecular weight of 375.56 g/mol. Its IUPAC name is lithium;(3-bromo-5-chloro-2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride.
| Compound Name | lithium;(3-bromo-5-chloro-2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride |
|---|---|
| PubChem CID | 174399366 |
| Molecular Formula | C13H18BrClLiO3P |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | lithium;(3-bromo-5-chloro-2,6-dimethoxyphenyl)-(2-methylpropylphosphanyl)methanone;hydride |
| SMILES | COc1c(Cl)cc(Br)c(OC)c1C(=O)PCC(C)C.[H-].[Li+] |
| InChI | InChI=1S/C13H17BrClO3P.Li.H/c1-7(2)6-19-13(16)10-11(17-3)8(14)5-9(15)12(10)18-4;;/h5,7,19H,6H2,1-4H3;;/q;+1;-1 |
| InChIKey | SLWHHJLFAPNSQS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|