About sodium;hydride;phenyl oxo(phenyl)methanesulfonate
sodium;hydride;phenyl oxo(phenyl)methanesulfonate (PubChem CID 174406653) has the molecular formula C13H11NaO4S
and a molecular weight of 286.28 g/mol. Its IUPAC name is sodium;hydride;phenyl oxo(phenyl)methanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;phenyl oxo(phenyl)methanesulfonate |
| PubChem CID | 174406653 |
| Molecular Formula | C13H11NaO4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | sodium;hydride;phenyl oxo(phenyl)methanesulfonate |
| SMILES | O=C(c1ccccc1)S(=O)(=O)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C13H10O4S.Na.H/c14-13(11-7-3-1-4-8-11)18(15,16)17-12-9-5-2-6-10-12;;/h1-10H;;/q;+1;-1 |
| InChIKey | BTMQVUGUTLCNDY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenyl oxo(phenyl)methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenyl oxo(phenyl)methanesulfonate?
The IUPAC name of sodium;hydride;phenyl oxo(phenyl)methanesulfonate (CID 174406653) is sodium;hydride;phenyl oxo(phenyl)methanesulfonate.
What is the SMILES notation for sodium;hydride;phenyl oxo(phenyl)methanesulfonate?
The canonical SMILES for sodium;hydride;phenyl oxo(phenyl)methanesulfonate is O=C(c1ccccc1)S(=O)(=O)Oc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenyl oxo(phenyl)methanesulfonate?
The InChIKey is BTMQVUGUTLCNDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O4S.Na.H/c14-13(11-7-3-1-4-8-11)18(15,16)17-12-9-5-2-6-10-12;;/h1-10H;;/q;+1;-1.
What are the key properties of sodium;hydride;phenyl oxo(phenyl)methanesulfonate?
sodium;hydride;phenyl oxo(phenyl)methanesulfonate has a molecular weight of 286.28 g/mol, XLogP of -0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenyl oxo(phenyl)methanesulfonate is sourced from PubChem (CID 174406653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).