About phenyl 1-oxoethanesulfonate
phenyl 1-oxoethanesulfonate (PubChem CID 18999205) has the molecular formula C8H8O4S
and a molecular weight of 200.22 g/mol. Its IUPAC name is phenyl 1-oxoethanesulfonate.
Molecular Properties
| Compound Name | phenyl 1-oxoethanesulfonate |
| PubChem CID | 18999205 |
| Molecular Formula | C8H8O4S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | phenyl 1-oxoethanesulfonate |
| SMILES | CC(=O)S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H8O4S/c1-7(9)13(10,11)12-8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | PHDUUCOVJGAQJK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 1-oxoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 1-oxoethanesulfonate?
The IUPAC name of phenyl 1-oxoethanesulfonate (CID 18999205) is phenyl 1-oxoethanesulfonate.
What is the SMILES notation for phenyl 1-oxoethanesulfonate?
The canonical SMILES for phenyl 1-oxoethanesulfonate is CC(=O)S(=O)(=O)Oc1ccccc1.
What is the InChIKey of phenyl 1-oxoethanesulfonate?
The InChIKey is PHDUUCOVJGAQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S/c1-7(9)13(10,11)12-8-5-3-2-4-6-8/h2-6H,1H3.
What are the key properties of phenyl 1-oxoethanesulfonate?
phenyl 1-oxoethanesulfonate has a molecular weight of 200.22 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 1-oxoethanesulfonate is sourced from PubChem (CID 18999205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).