C28H34N4O2 — CID 17440812
2-[4-(4-ethylpiperazin-1-yl)anilino]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide (PubChem CID 17440812) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-1-yl)anilino]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 17440812 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-1-yl)anilino]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
| SMILES | CCN1CCN(c2ccc(NC(C(=O)Nc3cc(C)ccc3OC)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H34N4O2/c1-4-31-16-18-32(19-17-31)24-13-11-23(12-14-24)29-27(22-8-6-5-7-9-22)28(33)30-25-20-21(2)10-15-26(25)34-3/h5-15,20,27,29H,4,16-19H2,1-3H3,(H,30,33) |
| InChIKey | QVBGTIHEFYRXCA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|