C12H16N6O — CID 174410204
4,4-diazidopentan-2-yloxymethylbenzene (PubChem CID 174410204) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 4,4-diazidopentan-2-yloxymethylbenzene.
| Compound Name | 4,4-diazidopentan-2-yloxymethylbenzene |
|---|---|
| PubChem CID | 174410204 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4,4-diazidopentan-2-yloxymethylbenzene |
| SMILES | CC(CC(C)(N=[N+]=[N-])N=[N+]=[N-])OCc1ccccc1 |
| InChI | InChI=1S/C12H16N6O/c1-10(8-12(2,15-17-13)16-18-14)19-9-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | OEARRJVOYHOJPZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|