C20H18N2O5S — CID 174417729
2-[[2-(4-methoxyphenyl)sulfonyl-3-pyridinyl]-methylamino]benzoic acid (PubChem CID 174417729) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)sulfonyl-3-pyridinyl]-methylamino]benzoic acid.
| Compound Name | 2-[[2-(4-methoxyphenyl)sulfonyl-3-pyridinyl]-methylamino]benzoic acid |
|---|---|
| PubChem CID | 174417729 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)sulfonyl-3-pyridinyl]-methylamino]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)c2ncccc2N(C)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c1-22(17-7-4-3-6-16(17)20(23)24)18-8-5-13-21-19(18)28(25,26)15-11-9-14(27-2)10-12-15/h3-13H,1-2H3,(H,23,24) |
| InChIKey | FBCGFVSIQXOSBH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |