About 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide
2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide (PubChem CID 15421721) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide |
| PubChem CID | 15421721 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide |
| SMILES | COc1ccc(S(=O)(=O)c2ccccc2C(=O)NN(C)C)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-18(2)17-16(19)14-6-4-5-7-15(14)23(20,21)13-10-8-12(22-3)9-11-13/h4-11H,1-3H3,(H,17,19) |
| InChIKey | ILIHXZONORKTBE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide?
The IUPAC name of 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide (CID 15421721) is 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide.
What is the SMILES notation for 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide?
The canonical SMILES for 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide is COc1ccc(S(=O)(=O)c2ccccc2C(=O)NN(C)C)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide?
The InChIKey is ILIHXZONORKTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-18(2)17-16(19)14-6-4-5-7-15(14)23(20,21)13-10-8-12(22-3)9-11-13/h4-11H,1-3H3,(H,17,19).
What are the key properties of 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide?
2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide has a molecular weight of 334.40 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide is sourced from PubChem (CID 15421721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).