C16H18N2O4S — CID 15421721
2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide (PubChem CID 15421721) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide.
| Compound Name | 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 15421721 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(4-methoxyphenyl)sulfonyl-N',N'-dimethylbenzohydrazide |
| SMILES | COc1ccc(S(=O)(=O)c2ccccc2C(=O)NN(C)C)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-18(2)17-16(19)14-6-4-5-7-15(14)23(20,21)13-10-8-12(22-3)9-11-13/h4-11H,1-3H3,(H,17,19) |
| InChIKey | ILIHXZONORKTBE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|