C23H24N2O6S — CID 177400242
2-[[(1R,2R)-2-azaniumyl-1,2-bis(4-methoxyphenyl)ethyl]carbamoyl]benzenesulfonate (PubChem CID 177400242) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-azaniumyl-1,2-bis(4-methoxyphenyl)ethyl]carbamoyl]benzenesulfonate.
| Compound Name | 2-[[(1R,2R)-2-azaniumyl-1,2-bis(4-methoxyphenyl)ethyl]carbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 177400242 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[[(1R,2R)-2-azaniumyl-1,2-bis(4-methoxyphenyl)ethyl]carbamoyl]benzenesulfonate |
| SMILES | COc1ccc([C@@H]([NH3+])[C@H](NC(=O)c2ccccc2S(=O)(=O)[O-])c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-30-17-11-7-15(8-12-17)21(24)22(16-9-13-18(31-2)14-10-16)25-23(26)19-5-3-4-6-20(19)32(27,28)29/h3-14,21-22H,24H2,1-2H3,(H,25,26)(H,27,28,29)/t21-,22-/m1/s1 |
| InChIKey | URPFGMODYYXZPN-FGZHOGPDSA-N |
| XLogP | 2.06 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|