About 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid
2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid (PubChem CID 174421018) has the molecular formula C27H21N3O4
and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid |
| PubChem CID | 174421018 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C=Cc2ccccc2)n1.O=[N+]([O-])c1cccc(C=Cc2ccccn2)c1 |
| InChI | InChI=1S/C14H11NO2.C13H10N2O2/c16-14(17)13-8-4-7-12(15-13)10-9-11-5-2-1-3-6-11;16-15(17)13-6-3-4-11(10-13)7-8-12-5-1-2-9-14-12/h1-10H,(H,16,17);1-10H |
| InChIKey | LSQOFTXYBVDTJK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid?
The IUPAC name of 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid (CID 174421018) is 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid?
The canonical SMILES for 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid is O=C(O)c1cccc(C=Cc2ccccc2)n1.O=[N+]([O-])c1cccc(C=Cc2ccccn2)c1.
What is the InChIKey of 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid?
The InChIKey is LSQOFTXYBVDTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2.C13H10N2O2/c16-14(17)13-8-4-7-12(15-13)10-9-11-5-2-1-3-6-11;16-15(17)13-6-3-4-11(10-13)7-8-12-5-1-2-9-14-12/h1-10H,(H,16,17);1-10H.
What are the key properties of 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid?
2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid has a molecular weight of 451.48 g/mol, XLogP of 6.11, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-nitrophenyl)ethenyl]pyridine;6-(2-phenylethenyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 174421018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).