About acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride
acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride (PubChem CID 174421202) has the molecular formula C7H18ClNO2S
and a molecular weight of 215.75 g/mol. Its IUPAC name is acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride.
Molecular Properties
| Compound Name | acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride |
| PubChem CID | 174421202 |
| Molecular Formula | C7H18ClNO2S |
| Molecular Weight | 215.75 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride |
| SMILES | CC(=O)O.C[N+](C)(C)CCS.[Cl-] |
| InChI | InChI=1S/C5H13NS.C2H4O2.ClH/c1-6(2,3)4-5-7;1-2(3)4;/h4-5H2,1-3H3;1H3,(H,3,4);1H |
| InChIKey | FLQBZJZBNJTPJB-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.75 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride?
The IUPAC name of acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride (CID 174421202) is acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride.
What is the SMILES notation for acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride?
The canonical SMILES for acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride is CC(=O)O.C[N+](C)(C)CCS.[Cl-].
What is the InChIKey of acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride?
The InChIKey is FLQBZJZBNJTPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS.C2H4O2.ClH/c1-6(2,3)4-5-7;1-2(3)4;/h4-5H2,1-3H3;1H3,(H,3,4);1H.
What are the key properties of acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride?
acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride has a molecular weight of 215.75 g/mol, XLogP of -2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;trimethyl(2-sulfanylethyl)azanium;chloride is sourced from PubChem (CID 174421202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).