C19H24ClN3O3 — CID 174422202
tert-butyl N-[[2-[(2-amino-4-chlorophenyl)-hydroxymethyl]phenyl]methylamino]carbamate (PubChem CID 174422202) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is tert-butyl N-[[2-[(2-amino-4-chlorophenyl)-hydroxymethyl]phenyl]methylamino]carbamate.
| Compound Name | tert-butyl N-[[2-[(2-amino-4-chlorophenyl)-hydroxymethyl]phenyl]methylamino]carbamate |
|---|---|
| PubChem CID | 174422202 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | tert-butyl N-[[2-[(2-amino-4-chlorophenyl)-hydroxymethyl]phenyl]methylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNCc1ccccc1C(O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C19H24ClN3O3/c1-19(2,3)26-18(25)23-22-11-12-6-4-5-7-14(12)17(24)15-9-8-13(20)10-16(15)21/h4-10,17,22,24H,11,21H2,1-3H3,(H,23,25) |
| InChIKey | ZJNRNBNKFWCIGX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|