C13H14N2O2S — CID 174422518
[2-(benzylamino)-1,3-thiazol-4-yl] propanoate (PubChem CID 174422518) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is [2-(benzylamino)-1,3-thiazol-4-yl] propanoate.
| Compound Name | [2-(benzylamino)-1,3-thiazol-4-yl] propanoate |
|---|---|
| PubChem CID | 174422518 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [2-(benzylamino)-1,3-thiazol-4-yl] propanoate |
| SMILES | CCC(=O)Oc1csc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C13H14N2O2S/c1-2-12(16)17-11-9-18-13(15-11)14-8-10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,14,15) |
| InChIKey | SZGSUDYHICZFLM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |