About butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate
butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate (PubChem CID 174422554) has the molecular formula C12H18N2O5S
and a molecular weight of 302.35 g/mol. Its IUPAC name is butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate.
Molecular Properties
| Compound Name | butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate |
| PubChem CID | 174422554 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate |
| SMILES | CCCCOC(=O)OS(=O)(=O)CCc1ncccc1N |
| InChI | InChI=1S/C12H18N2O5S/c1-2-3-8-18-12(15)19-20(16,17)9-6-11-10(13)5-4-7-14-11/h4-5,7H,2-3,6,8-9,13H2,1H3 |
| InChIKey | HPIRNKRHDLCUBO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate?
The IUPAC name of butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate (CID 174422554) is butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate.
What is the SMILES notation for butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate?
The canonical SMILES for butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate is CCCCOC(=O)OS(=O)(=O)CCc1ncccc1N.
What is the InChIKey of butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate?
The InChIKey is HPIRNKRHDLCUBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O5S/c1-2-3-8-18-12(15)19-20(16,17)9-6-11-10(13)5-4-7-14-11/h4-5,7H,2-3,6,8-9,13H2,1H3.
What are the key properties of butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate?
butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate has a molecular weight of 302.35 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butoxycarbonyl 2-(3-amino-2-pyridinyl)ethanesulfonate is sourced from PubChem (CID 174422554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).