C21H38N2O4S — CID 174423360
(2S)-4-[[3-acetylsulfanylpropyl(2-cyclohexylethyl)carbamoyl]amino]-2,3,3-trimethylbutanoic acid (PubChem CID 174423360) has the molecular formula C21H38N2O4S and a molecular weight of 414.61 g/mol. Its IUPAC name is (2S)-4-[[3-acetylsulfanylpropyl(2-cyclohexylethyl)carbamoyl]amino]-2,3,3-trimethylbutanoic acid.
| Compound Name | (2S)-4-[[3-acetylsulfanylpropyl(2-cyclohexylethyl)carbamoyl]amino]-2,3,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 174423360 |
| Molecular Formula | C21H38N2O4S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (2S)-4-[[3-acetylsulfanylpropyl(2-cyclohexylethyl)carbamoyl]amino]-2,3,3-trimethylbutanoic acid |
| SMILES | CC(=O)SCCCN(CCC1CCCCC1)C(=O)NCC(C)(C)[C@H](C)C(=O)O |
| InChI | InChI=1S/C21H38N2O4S/c1-16(19(25)26)21(3,4)15-22-20(27)23(12-8-14-28-17(2)24)13-11-18-9-6-5-7-10-18/h16,18H,5-15H2,1-4H3,(H,22,27)(H,25,26)/t16-/m1/s1 |
| InChIKey | IKZPRVGIXZWSRH-MRXNPFEDSA-N |
| XLogP | 4.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|