C26H38N4O10S — CID 139821847
S-[2-[2-cyclopentylethyl-[[(2S)-1-(10-hydroxy-5-methyl-8,12,15-trioxo-7,13,14-trioxa-2,5-diazatricyclo[8.3.2.01,6]pentadecan-2-yl)-1-oxopropan-2-yl]carbamoyl]amino]ethyl] ethanethioate (PubChem CID 139821847) has the molecular formula C26H38N4O10S and a molecular weight of 598.68 g/mol. Its IUPAC name is S-[2-[2-cyclopentylethyl-[[(2S)-1-(10-hydroxy-5-methyl-8,12,15-trioxo-7,13,14-trioxa-2,5-diazatricyclo[8.3.2.01,6]pentadecan-2-yl)-1-oxopropan-2-yl]carbamoyl]amino]ethyl] ethanethioate.
| Compound Name | S-[2-[2-cyclopentylethyl-[[(2S)-1-(10-hydroxy-5-methyl-8,12,15-trioxo-7,13,14-trioxa-2,5-diazatricyclo[8.3.2.01,6]pentadecan-2-yl)-1-oxopropan-2-yl]carbamoyl]amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 139821847 |
| Molecular Formula | C26H38N4O10S |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | S-[2-[2-cyclopentylethyl-[[(2S)-1-(10-hydroxy-5-methyl-8,12,15-trioxo-7,13,14-trioxa-2,5-diazatricyclo[8.3.2.01,6]pentadecan-2-yl)-1-oxopropan-2-yl]carbamoyl]amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCN(CCC1CCCC1)C(=O)N[C@@H](C)C(=O)N1CCN(C)C2OC(=O)CC3(O)CC(=O)OC21OC3=O |
| InChI | InChI=1S/C26H38N4O10S/c1-16(27-24(36)29(12-13-41-17(2)31)9-8-18-6-4-5-7-18)21(34)30-11-10-28(3)22-26(30)39-20(33)15-25(37,23(35)40-26)14-19(32)38-22/h16,18,22,37H,4-15H2,1-3H3,(H,27,36)/t16-,22?,25?,26?/m0/s1 |
| InChIKey | SYQVGGDLRTWUOW-WWWUBADESA-N |
| XLogP | 0.17 |
| TPSA | 172.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|