C18H26N2O4S — CID 22722978
2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-methylbutanoic acid (PubChem CID 22722978) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22722978 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(=O)SCCN(CCc1ccccc1)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C18H26N2O4S/c1-13(2)16(17(22)23)19-18(24)20(11-12-25-14(3)21)10-9-15-7-5-4-6-8-15/h4-8,13,16H,9-12H2,1-3H3,(H,19,24)(H,22,23) |
| InChIKey | XKEBKMXBGIERKV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|