C27H34N4O5S — CID 22722740
S-[2-[[3-(4-nitrophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate (PubChem CID 22722740) has the molecular formula C27H34N4O5S and a molecular weight of 526.66 g/mol. Its IUPAC name is S-[2-[[3-(4-nitrophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate.
| Compound Name | S-[2-[[3-(4-nitrophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 22722740 |
| Molecular Formula | C27H34N4O5S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | S-[2-[[3-(4-nitrophenyl)-1-oxo-1-piperidin-1-ylpropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCN(CCc1ccccc1)C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C27H34N4O5S/c1-21(32)37-19-18-30(17-14-22-8-4-2-5-9-22)27(34)28-25(26(33)29-15-6-3-7-16-29)20-23-10-12-24(13-11-23)31(35)36/h2,4-5,8-13,25H,3,6-7,14-20H2,1H3,(H,28,34) |
| InChIKey | VVZLVBNFWBMSPC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|