C28H34N6O5S — CID 22723174
S-[2-[[1-(3-imidazol-1-ylpropylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate (PubChem CID 22723174) has the molecular formula C28H34N6O5S and a molecular weight of 566.68 g/mol. Its IUPAC name is S-[2-[[1-(3-imidazol-1-ylpropylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate.
| Compound Name | S-[2-[[1-(3-imidazol-1-ylpropylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 22723174 |
| Molecular Formula | C28H34N6O5S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | S-[2-[[1-(3-imidazol-1-ylpropylamino)-3-(4-nitrophenyl)-1-oxopropan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCN(CCc1ccccc1)C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C28H34N6O5S/c1-22(35)40-19-18-33(16-12-23-6-3-2-4-7-23)28(37)31-26(20-24-8-10-25(11-9-24)34(38)39)27(36)30-13-5-15-32-17-14-29-21-32/h2-4,6-11,14,17,21,26H,5,12-13,15-16,18-20H2,1H3,(H,30,36)(H,31,37) |
| InChIKey | ATKPPMYDQXQYJR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|