C29H39N5O5S — CID 142647637
S-[2-[[(2S)-1-amino-2-[(4-nitrophenyl)methyl]-1-oxo-4-piperidin-1-ylbutan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate (PubChem CID 142647637) has the molecular formula C29H39N5O5S and a molecular weight of 569.73 g/mol. Its IUPAC name is S-[2-[[(2S)-1-amino-2-[(4-nitrophenyl)methyl]-1-oxo-4-piperidin-1-ylbutan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate.
| Compound Name | S-[2-[[(2S)-1-amino-2-[(4-nitrophenyl)methyl]-1-oxo-4-piperidin-1-ylbutan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 142647637 |
| Molecular Formula | C29H39N5O5S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | S-[2-[[(2S)-1-amino-2-[(4-nitrophenyl)methyl]-1-oxo-4-piperidin-1-ylbutan-2-yl]carbamoyl-(2-phenylethyl)amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCCN(CCc1ccccc1)C(=O)N[C@](CCN1CCCCC1)(Cc1ccc([N+](=O)[O-])cc1)C(N)=O |
| InChI | InChI=1S/C29H39N5O5S/c1-23(35)40-21-20-33(18-14-24-8-4-2-5-9-24)28(37)31-29(27(30)36,15-19-32-16-6-3-7-17-32)22-25-10-12-26(13-11-25)34(38)39/h2,4-5,8-13H,3,6-7,14-22H2,1H3,(H2,30,36)(H,31,37)/t29-/m1/s1 |
| InChIKey | YDSVSIVZOCONBU-GDLZYMKVSA-N |
| XLogP | 3.77 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|