C31H41N5O7S — CID 22723384
tert-butyl 4-[2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-(4-nitrophenyl)propanoyl]piperazine-1-carboxylate (PubChem CID 22723384) has the molecular formula C31H41N5O7S and a molecular weight of 627.76 g/mol. Its IUPAC name is tert-butyl 4-[2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-(4-nitrophenyl)propanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-(4-nitrophenyl)propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22723384 |
| Molecular Formula | C31H41N5O7S |
| Molecular Weight | 627.76 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | tert-butyl 4-[2-[[2-acetylsulfanylethyl(2-phenylethyl)carbamoyl]amino]-3-(4-nitrophenyl)propanoyl]piperazine-1-carboxylate |
| SMILES | CC(=O)SCCN(CCc1ccccc1)C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H41N5O7S/c1-23(37)44-21-20-34(15-14-24-8-6-5-7-9-24)29(39)32-27(22-25-10-12-26(13-11-25)36(41)42)28(38)33-16-18-35(19-17-33)30(40)43-31(2,3)4/h5-13,27H,14-22H2,1-4H3,(H,32,39) |
| InChIKey | IGSRLFBEGVOCMD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|