C16H19N5O2S — CID 174425024
4-amino-5-(2-piperazin-1-ylphenyl)thiophene-2,3-dicarboxamide (PubChem CID 174425024) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 4-amino-5-(2-piperazin-1-ylphenyl)thiophene-2,3-dicarboxamide.
| Compound Name | 4-amino-5-(2-piperazin-1-ylphenyl)thiophene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 174425024 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 4-amino-5-(2-piperazin-1-ylphenyl)thiophene-2,3-dicarboxamide |
| SMILES | NC(=O)c1sc(-c2ccccc2N2CCNCC2)c(N)c1C(N)=O |
| InChI | InChI=1S/C16H19N5O2S/c17-12-11(15(18)22)14(16(19)23)24-13(12)9-3-1-2-4-10(9)21-7-5-20-6-8-21/h1-4,20H,5-8,17H2,(H2,18,22)(H2,19,23) |
| InChIKey | VFBHEQFUICEPBY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |