C20H16N4O4 — CID 174426757
4-[2-[2-(2-oxo-1,3-benzodioxol-5-yl)ethylamino]pyrimidin-4-yl]benzamide (PubChem CID 174426757) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-[2-[2-(2-oxo-1,3-benzodioxol-5-yl)ethylamino]pyrimidin-4-yl]benzamide.
| Compound Name | 4-[2-[2-(2-oxo-1,3-benzodioxol-5-yl)ethylamino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 174426757 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 4-[2-[2-(2-oxo-1,3-benzodioxol-5-yl)ethylamino]pyrimidin-4-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccnc(NCCc3ccc4oc(=O)oc4c3)n2)cc1 |
| InChI | InChI=1S/C20H16N4O4/c21-18(25)14-4-2-13(3-5-14)15-8-10-23-19(24-15)22-9-7-12-1-6-16-17(11-12)28-20(26)27-16/h1-6,8,10-11H,7,9H2,(H2,21,25)(H,22,23,24) |
| InChIKey | JBPFIWGPCIDCEC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |