C20H20N4O3 — CID 22142652
4-[2-[(2,6-dimethoxyphenyl)methylamino]pyrimidin-4-yl]benzamide (PubChem CID 22142652) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-[2-[(2,6-dimethoxyphenyl)methylamino]pyrimidin-4-yl]benzamide.
| Compound Name | 4-[2-[(2,6-dimethoxyphenyl)methylamino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 22142652 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[2-[(2,6-dimethoxyphenyl)methylamino]pyrimidin-4-yl]benzamide |
| SMILES | COc1cccc(OC)c1CNc1nccc(-c2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C20H20N4O3/c1-26-17-4-3-5-18(27-2)15(17)12-23-20-22-11-10-16(24-20)13-6-8-14(9-7-13)19(21)25/h3-11H,12H2,1-2H3,(H2,21,25)(H,22,23,24) |
| InChIKey | ILUBZERLFZVONF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |