C24H22N4O2 — CID 22143028
4-[2-(1-naphthalen-2-yloxypropylamino)pyrimidin-4-yl]benzamide (PubChem CID 22143028) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[2-(1-naphthalen-2-yloxypropylamino)pyrimidin-4-yl]benzamide.
| Compound Name | 4-[2-(1-naphthalen-2-yloxypropylamino)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 22143028 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4-[2-(1-naphthalen-2-yloxypropylamino)pyrimidin-4-yl]benzamide |
| SMILES | CCC(Nc1nccc(-c2ccc(C(N)=O)cc2)n1)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H22N4O2/c1-2-22(30-20-12-11-16-5-3-4-6-19(16)15-20)28-24-26-14-13-21(27-24)17-7-9-18(10-8-17)23(25)29/h3-15,22H,2H2,1H3,(H2,25,29)(H,26,27,28) |
| InChIKey | QQSWPQVIDBMYRZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|