C15H22N4O2S — CID 174427704
3-N-hexyl-3-N-methyl-1,1-dioxo-4-N-phenyl-1,2,5-thiadiazole-3,4-diamine (PubChem CID 174427704) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-N-hexyl-3-N-methyl-1,1-dioxo-4-N-phenyl-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-hexyl-3-N-methyl-1,1-dioxo-4-N-phenyl-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 174427704 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-N-hexyl-3-N-methyl-1,1-dioxo-4-N-phenyl-1,2,5-thiadiazole-3,4-diamine |
| SMILES | CCCCCCN(C)C1=NS(=O)(=O)N=C1Nc1ccccc1 |
| InChI | InChI=1S/C15H22N4O2S/c1-3-4-5-9-12-19(2)15-14(17-22(20,21)18-15)16-13-10-7-6-8-11-13/h6-8,10-11H,3-5,9,12H2,1-2H3,(H,16,17) |
| InChIKey | OGXGUWXYIKRFMF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|