About 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate
2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate (PubChem CID 174432101) has the molecular formula C21H18O3
and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate |
| PubChem CID | 174432101 |
| Molecular Formula | C21H18O3 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(C)=CC1C=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C21H18O3/c1-13(2)20(22)24-21(23)14(3)12-17-11-10-16-7-4-6-15-8-5-9-18(17)19(15)16/h4-12,17H,1H2,2-3H3 |
| InChIKey | AQSKAPNOUMPSJZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate?
The IUPAC name of 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate (CID 174432101) is 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate.
What is the SMILES notation for 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate?
The canonical SMILES for 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate is C=C(C)C(=O)OC(=O)C(C)=CC1C=Cc2cccc3cccc1c23.
What is the InChIKey of 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate?
The InChIKey is AQSKAPNOUMPSJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O3/c1-13(2)20(22)24-21(23)14(3)12-17-11-10-16-7-4-6-15-8-5-9-18(17)19(15)16/h4-12,17H,1H2,2-3H3.
What are the key properties of 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate?
2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate has a molecular weight of 318.37 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoyl 2-methyl-3-(1H-phenalen-1-yl)prop-2-enoate is sourced from PubChem (CID 174432101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).