C19H22O9 — CID 174433820
2-hydroxypentan-3-yl 2-prop-2-enoyloxyprop-2-enoate;phthalic acid (PubChem CID 174433820) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-hydroxypentan-3-yl 2-prop-2-enoyloxyprop-2-enoate;phthalic acid.
| Compound Name | 2-hydroxypentan-3-yl 2-prop-2-enoyloxyprop-2-enoate;phthalic acid |
|---|---|
| PubChem CID | 174433820 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-hydroxypentan-3-yl 2-prop-2-enoyloxyprop-2-enoate;phthalic acid |
| SMILES | C=CC(=O)OC(=C)C(=O)OC(CC)C(C)O.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C11H16O5.C8H6O4/c1-5-9(7(3)12)16-11(14)8(4)15-10(13)6-2;9-7(10)5-3-1-2-4-6(5)8(11)12/h6-7,9,12H,2,4-5H2,1,3H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | UPLVTTUXNAMIGI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|