C11H9ClN4O3 — CID 174434238
3-(4-chloro-3-nitrophenyl)-6-methyl-1,2-dihydro-1,2,4-triazine-5-carbaldehyde (PubChem CID 174434238) has the molecular formula C11H9ClN4O3 and a molecular weight of 280.67 g/mol. Its IUPAC name is 3-(4-chloro-3-nitrophenyl)-6-methyl-1,2-dihydro-1,2,4-triazine-5-carbaldehyde.
| Compound Name | 3-(4-chloro-3-nitrophenyl)-6-methyl-1,2-dihydro-1,2,4-triazine-5-carbaldehyde |
|---|---|
| PubChem CID | 174434238 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 3-(4-chloro-3-nitrophenyl)-6-methyl-1,2-dihydro-1,2,4-triazine-5-carbaldehyde |
| SMILES | CC1=C(C=O)N=C(c2ccc(Cl)c([N+](=O)[O-])c2)NN1 |
| InChI | InChI=1S/C11H9ClN4O3/c1-6-9(5-17)13-11(15-14-6)7-2-3-8(12)10(4-7)16(18)19/h2-5,14H,1H3,(H,13,15) |
| InChIKey | HRLKTKGXERPLAW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|