C11H11F2NO2 — CID 174436705
(2S)-2-amino-5-(3,5-difluorophenyl)-4-oxopentanal (PubChem CID 174436705) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is (2S)-2-amino-5-(3,5-difluorophenyl)-4-oxopentanal.
| Compound Name | (2S)-2-amino-5-(3,5-difluorophenyl)-4-oxopentanal |
|---|---|
| PubChem CID | 174436705 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (2S)-2-amino-5-(3,5-difluorophenyl)-4-oxopentanal |
| SMILES | N[C@H](C=O)CC(=O)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H11F2NO2/c12-8-1-7(2-9(13)4-8)3-11(16)5-10(14)6-15/h1-2,4,6,10H,3,5,14H2/t10-/m0/s1 |
| InChIKey | BYAILNHZFVZENQ-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|