C15H24FN3O4 — CID 174437626
tert-butyl (3S)-3-[(2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carbonyl]-2-iminopentanoate (PubChem CID 174437626) has the molecular formula C15H24FN3O4 and a molecular weight of 329.37 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carbonyl]-2-iminopentanoate.
| Compound Name | tert-butyl (3S)-3-[(2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carbonyl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174437626 |
| Molecular Formula | C15H24FN3O4 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl (3S)-3-[(2S,4S)-2-carbamoyl-4-fluoropyrrolidine-1-carbonyl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)[C@H](CC)C(=O)N1C[C@@H](F)C[C@H]1C(N)=O |
| InChI | InChI=1S/C15H24FN3O4/c1-5-9(11(17)14(22)23-15(2,3)4)13(21)19-7-8(16)6-10(19)12(18)20/h8-10,17H,5-7H2,1-4H3,(H2,18,20)/b17-11-/t8-,9-,10-/m0/s1 |
| InChIKey | SUSVXGRGHRGLSD-HLEJUGSVSA-N |
| XLogP | 0.80 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|