C28H30ClFN4O6S2 — CID 174439504
2-[(4-chlorophenyl)sulfonylamino]-3-fluoro-N-[4-[1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]benzamide (PubChem CID 174439504) has the molecular formula C28H30ClFN4O6S2 and a molecular weight of 637.16 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-3-fluoro-N-[4-[1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-3-fluoro-N-[4-[1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 174439504 |
| Molecular Formula | C28H30ClFN4O6S2 |
| Molecular Weight | 637.16 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-3-fluoro-N-[4-[1-[4-(2-hydroxyethyl)piperazin-1-yl]prop-2-enylsulfonyl]phenyl]benzamide |
| SMILES | C=CC(N1CCN(CCO)CC1)S(=O)(=O)c1ccc(NC(=O)c2cccc(F)c2NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H30ClFN4O6S2/c1-2-26(34-16-14-33(15-17-34)18-19-35)41(37,38)22-12-8-21(9-13-22)31-28(36)24-4-3-5-25(30)27(24)32-42(39,40)23-10-6-20(29)7-11-23/h2-13,26,32,35H,1,14-19H2,(H,31,36) |
| InChIKey | LJJNXAJIXQCIKZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|