C27H28Cl2N4O5S2 — CID 174425063
5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[3-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]benzamide (PubChem CID 174425063) has the molecular formula C27H28Cl2N4O5S2 and a molecular weight of 623.58 g/mol. Its IUPAC name is 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[3-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]benzamide.
| Compound Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[3-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 174425063 |
| Molecular Formula | C27H28Cl2N4O5S2 |
| Molecular Weight | 623.58 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | 5-chloro-2-[(4-chlorophenyl)sulfonylamino]-N-[3-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]benzamide |
| SMILES | C=CC(N1CCN(C)CC1)S(=O)(=O)c1cccc(NC(=O)c2cc(Cl)ccc2NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H28Cl2N4O5S2/c1-3-26(33-15-13-32(2)14-16-33)39(35,36)23-6-4-5-21(18-23)30-27(34)24-17-20(29)9-12-25(24)31-40(37,38)22-10-7-19(28)8-11-22/h3-12,17-18,26,31H,1,13-16H2,2H3,(H,30,34) |
| InChIKey | KGPQPWBEHMNPMN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|