C27H28ClN3O7S3 — CID 175237943
2-[(4-chlorophenyl)sulfonylamino]-4,5-dimethoxy-N-[4-[1-(1,3-thiazolidin-3-yl)prop-2-enylsulfonyl]phenyl]benzamide (PubChem CID 175237943) has the molecular formula C27H28ClN3O7S3 and a molecular weight of 638.19 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-4,5-dimethoxy-N-[4-[1-(1,3-thiazolidin-3-yl)prop-2-enylsulfonyl]phenyl]benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-4,5-dimethoxy-N-[4-[1-(1,3-thiazolidin-3-yl)prop-2-enylsulfonyl]phenyl]benzamide |
|---|---|
| PubChem CID | 175237943 |
| Molecular Formula | C27H28ClN3O7S3 |
| Molecular Weight | 638.19 g/mol |
| Exact Mass | 637.08 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-4,5-dimethoxy-N-[4-[1-(1,3-thiazolidin-3-yl)prop-2-enylsulfonyl]phenyl]benzamide |
| SMILES | C=CC(N1CCSC1)S(=O)(=O)c1ccc(NC(=O)c2cc(OC)c(OC)cc2NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H28ClN3O7S3/c1-4-26(31-13-14-39-17-31)40(33,34)20-11-7-19(8-12-20)29-27(32)22-15-24(37-2)25(38-3)16-23(22)30-41(35,36)21-9-5-18(28)6-10-21/h4-12,15-16,26,30H,1,13-14,17H2,2-3H3,(H,29,32) |
| InChIKey | YGSSWVXKWXMAAL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|